About 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine
9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine (PubChem CID 13225518) has the molecular formula C20H16ClFN4
and a molecular weight of 366.83 g/mol. Its IUPAC name is 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine.
Molecular Properties
| Compound Name | 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine |
| PubChem CID | 13225518 |
| Molecular Formula | C20H16ClFN4 |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine |
| SMILES | CN(C)c1ncc2c(n1)-c1ccc(Cl)cc1C(c1ccccc1F)=NC2 |
| InChI | InChI=1S/C20H16ClFN4/c1-26(2)20-24-11-12-10-23-19(15-5-3-4-6-17(15)22)16-9-13(21)7-8-14(16)18(12)25-20/h3-9,11H,10H2,1-2H3 |
| InChIKey | FXBGWQBBFOHQAR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine?
The IUPAC name of 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine (CID 13225518) is 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine.
What is the SMILES notation for 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine?
The canonical SMILES for 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine is CN(C)c1ncc2c(n1)-c1ccc(Cl)cc1C(c1ccccc1F)=NC2.
What is the InChIKey of 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine?
The InChIKey is FXBGWQBBFOHQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClFN4/c1-26(2)20-24-11-12-10-23-19(15-5-3-4-6-17(15)22)16-9-13(21)7-8-14(16)18(12)25-20/h3-9,11H,10H2,1-2H3.
What are the key properties of 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine?
9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine has a molecular weight of 366.83 g/mol, XLogP of 4.35, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-7-(2-fluorophenyl)-N,N-dimethyl-5H-pyrimido[5,4-d][2]benzazepin-2-amine is sourced from PubChem (CID 13225518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).