C23H23ClFN5 — CID 13225519
N-[9-chloro-7-(2-fluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 13225519) has the molecular formula C23H23ClFN5 and a molecular weight of 423.92 g/mol. Its IUPAC name is N-[9-chloro-7-(2-fluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[9-chloro-7-(2-fluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 13225519 |
| Molecular Formula | C23H23ClFN5 |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-[9-chloro-7-(2-fluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1ncc2c(n1)-c1ccc(Cl)cc1C(c1ccccc1F)=NC2 |
| InChI | InChI=1S/C23H23ClFN5/c1-30(2)11-5-10-26-23-28-14-15-13-27-22(18-6-3-4-7-20(18)25)19-12-16(24)8-9-17(19)21(15)29-23/h3-4,6-9,12,14H,5,10-11,13H2,1-2H3,(H,26,28,29) |
| InChIKey | NQTZVSXZOCJJSF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|