C8H11Cl3INO — CID 13225942
(4S,5R)-5-(iodomethyl)-4-propyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 13225942) has the molecular formula C8H11Cl3INO and a molecular weight of 370.45 g/mol. Its IUPAC name is (4S,5R)-5-(iodomethyl)-4-propyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5R)-5-(iodomethyl)-4-propyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 13225942 |
| Molecular Formula | C8H11Cl3INO |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 368.90 |
| IUPAC Name | (4S,5R)-5-(iodomethyl)-4-propyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCC[C@@H]1N=C(C(Cl)(Cl)Cl)O[C@H]1CI |
| InChI | InChI=1S/C8H11Cl3INO/c1-2-3-5-6(4-12)14-7(13-5)8(9,10)11/h5-6H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | DBUPPFMCRGTOQQ-WDSKDSINSA-N |
| XLogP | 3.76 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|