C9H16 — CID 13226239
(4R,5R)-1,4,5-trimethylcyclohexene (PubChem CID 13226239) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is (4R,5R)-1,4,5-trimethylcyclohexene.
| Compound Name | (4R,5R)-1,4,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 13226239 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (4R,5R)-1,4,5-trimethylcyclohexene |
| SMILES | CC1=CC[C@@H](C)[C@H](C)C1 |
| InChI | InChI=1S/C9H16/c1-7-4-5-8(2)9(3)6-7/h4,8-9H,5-6H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | FNZUANSNHGITHR-RKDXNWHRSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|