C10H20N2O4 — CID 13226340
(2R,3R)-2,3-dihydroxy-N,N'-dipropylbutanediamide (PubChem CID 13226340) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-N,N'-dipropylbutanediamide.
| Compound Name | (2R,3R)-2,3-dihydroxy-N,N'-dipropylbutanediamide |
|---|---|
| PubChem CID | 13226340 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-N,N'-dipropylbutanediamide |
| SMILES | CCCNC(=O)[C@H](O)[C@@H](O)C(=O)NCCC |
| InChI | InChI=1S/C10H20N2O4/c1-3-5-11-9(15)7(13)8(14)10(16)12-6-4-2/h7-8,13-14H,3-6H2,1-2H3,(H,11,15)(H,12,16)/t7-,8-/m1/s1 |
| InChIKey | GCNAACQQQUCOMO-HTQZYQBOSA-N |
| XLogP | -1.24 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |