C12F14 — CID 13226577
1,3,3,4,4,5,5,6,6-nonafluoro-2-(2,3,4,5,6-pentafluorophenyl)cyclohexene (PubChem CID 13226577) has the molecular formula C12F14 and a molecular weight of 410.10 g/mol. Its IUPAC name is 1,3,3,4,4,5,5,6,6-nonafluoro-2-(2,3,4,5,6-pentafluorophenyl)cyclohexene.
| Compound Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-(2,3,4,5,6-pentafluorophenyl)cyclohexene |
|---|---|
| PubChem CID | 13226577 |
| Molecular Formula | C12F14 |
| Molecular Weight | 410.10 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-(2,3,4,5,6-pentafluorophenyl)cyclohexene |
| SMILES | FC1=C(c2c(F)c(F)c(F)c(F)c2F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12F14/c13-3-1(4(14)6(16)7(17)5(3)15)2-8(18)10(21,22)12(25,26)11(23,24)9(2,19)20 |
| InChIKey | FLSALHJOEPSBJX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.10 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|