C21H24ClNO3 — CID 13228206
6,7a-ditert-butyl-3-(4-chlorophenyl)-3aH-1,2-benzoxazole-4,7-dione (PubChem CID 13228206) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is 6,7a-ditert-butyl-3-(4-chlorophenyl)-3aH-1,2-benzoxazole-4,7-dione.
| Compound Name | 6,7a-ditert-butyl-3-(4-chlorophenyl)-3aH-1,2-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 13228206 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 6,7a-ditert-butyl-3-(4-chlorophenyl)-3aH-1,2-benzoxazole-4,7-dione |
| SMILES | CC(C)(C)C1=CC(=O)C2C(c3ccc(Cl)cc3)=NOC2(C(C)(C)C)C1=O |
| InChI | InChI=1S/C21H24ClNO3/c1-19(2,3)14-11-15(24)16-17(12-7-9-13(22)10-8-12)23-26-21(16,18(14)25)20(4,5)6/h7-11,16H,1-6H3 |
| InChIKey | PDAIRVOGZHBIQA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |