C17H17BrFNO3 — CID 13229091
2-(4-bromo-2-fluoro-5-propan-2-yloxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 13229091) has the molecular formula C17H17BrFNO3 and a molecular weight of 382.23 g/mol. Its IUPAC name is 2-(4-bromo-2-fluoro-5-propan-2-yloxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(4-bromo-2-fluoro-5-propan-2-yloxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 13229091 |
| Molecular Formula | C17H17BrFNO3 |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 2-(4-bromo-2-fluoro-5-propan-2-yloxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | CC(C)Oc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Br |
| InChI | InChI=1S/C17H17BrFNO3/c1-9(2)23-15-8-14(13(19)7-12(15)18)20-16(21)10-5-3-4-6-11(10)17(20)22/h7-9H,3-6H2,1-2H3 |
| InChIKey | ZWGHFIJLYAFCHT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|