About 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide
2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide (PubChem CID 13229299) has the molecular formula C17H21FN2O3
and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide.
Molecular Properties
| Compound Name | 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide |
| PubChem CID | 13229299 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide |
| SMILES | CCC(C)(CC)c1cc(NC(=O)c2c(F)cccc2OC)on1 |
| InChI | InChI=1S/C17H21FN2O3/c1-5-17(3,6-2)13-10-14(23-20-13)19-16(21)15-11(18)8-7-9-12(15)22-4/h7-10H,5-6H2,1-4H3,(H,19,21) |
| InChIKey | OTUDNJHNWMOCCK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide?
The IUPAC name of 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide (CID 13229299) is 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide.
What is the SMILES notation for 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide?
The canonical SMILES for 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide is CCC(C)(CC)c1cc(NC(=O)c2c(F)cccc2OC)on1.
What is the InChIKey of 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide?
The InChIKey is OTUDNJHNWMOCCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FN2O3/c1-5-17(3,6-2)13-10-14(23-20-13)19-16(21)15-11(18)8-7-9-12(15)22-4/h7-10H,5-6H2,1-4H3,(H,19,21).
What are the key properties of 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide?
2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide has a molecular weight of 320.36 g/mol, XLogP of 4.15, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-methoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide is sourced from PubChem (CID 13229299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).