About 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide
2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide (PubChem CID 13229305) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide |
| PubChem CID | 13229305 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide |
| SMILES | CCCc1cc(NC(=O)c2c(C)cccc2C)on1 |
| InChI | InChI=1S/C15H18N2O2/c1-4-6-12-9-13(19-17-12)16-15(18)14-10(2)7-5-8-11(14)3/h5,7-9H,4,6H2,1-3H3,(H,16,18) |
| InChIKey | KKYYXLPWUOWASR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide?
The IUPAC name of 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide (CID 13229305) is 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide.
What is the SMILES notation for 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide?
The canonical SMILES for 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide is CCCc1cc(NC(=O)c2c(C)cccc2C)on1.
What is the InChIKey of 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide?
The InChIKey is KKYYXLPWUOWASR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2/c1-4-6-12-9-13(19-17-12)16-15(18)14-10(2)7-5-8-11(14)3/h5,7-9H,4,6H2,1-3H3,(H,16,18).
What are the key properties of 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide?
2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide has a molecular weight of 258.32 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-N-(3-propyl-1,2-oxazol-5-yl)benzamide is sourced from PubChem (CID 13229305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).