C6H8N2O5 — CID 13229391
5,5-dimethoxy-1,3-diazinane-2,4,6-trione (PubChem CID 13229391) has the molecular formula C6H8N2O5 and a molecular weight of 188.14 g/mol. Its IUPAC name is 5,5-dimethoxy-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-dimethoxy-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 13229391 |
| Molecular Formula | C6H8N2O5 |
| Molecular Weight | 188.14 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 5,5-dimethoxy-1,3-diazinane-2,4,6-trione |
| SMILES | COC1(OC)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C6H8N2O5/c1-12-6(13-2)3(9)7-5(11)8-4(6)10/h1-2H3,(H2,7,8,9,10,11) |
| InChIKey | ZINVTVVIWPISEP-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.14 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|