About 2-ethenylnaphthalene
2-ethenylnaphthalene (PubChem CID 13230) has the molecular formula C12H10
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-ethenylnaphthalene.
Molecular Properties
| Compound Name | 2-ethenylnaphthalene |
| PubChem CID | 13230 |
| Molecular Formula | C12H10 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 2-ethenylnaphthalene |
| SMILES | C=Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H10/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h2-9H,1H2 |
| InChIKey | KXYAVSFOJVUIHT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-ethenylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylnaphthalene?
The IUPAC name of 2-ethenylnaphthalene (CID 13230) is 2-ethenylnaphthalene.
What is the SMILES notation for 2-ethenylnaphthalene?
The canonical SMILES for 2-ethenylnaphthalene is C=Cc1ccc2ccccc2c1.
What is the InChIKey of 2-ethenylnaphthalene?
The InChIKey is KXYAVSFOJVUIHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h2-9H,1H2.
What are the key properties of 2-ethenylnaphthalene?
2-ethenylnaphthalene has a molecular weight of 154.21 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylnaphthalene is sourced from PubChem (CID 13230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).