C18H10F4S2 — CID 13231606
1,2,4,5-tetrafluoro-3,6-bis(phenylsulfanyl)benzene (PubChem CID 13231606) has the molecular formula C18H10F4S2 and a molecular weight of 366.40 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-bis(phenylsulfanyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3,6-bis(phenylsulfanyl)benzene |
|---|---|
| PubChem CID | 13231606 |
| Molecular Formula | C18H10F4S2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-bis(phenylsulfanyl)benzene |
| SMILES | Fc1c(F)c(Sc2ccccc2)c(F)c(F)c1Sc1ccccc1 |
| InChI | InChI=1S/C18H10F4S2/c19-13-15(21)18(24-12-9-5-2-6-10-12)16(22)14(20)17(13)23-11-7-3-1-4-8-11/h1-10H |
| InChIKey | RRVJVCMUQWDHDN-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|