C19H32O5S — CID 13231966
6-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]sulfanylhexanoic acid (PubChem CID 13231966) has the molecular formula C19H32O5S and a molecular weight of 372.53 g/mol. Its IUPAC name is 6-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]sulfanylhexanoic acid.
| Compound Name | 6-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 13231966 |
| Molecular Formula | C19H32O5S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 6-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]sulfanylhexanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1SCCCCCC(=O)O |
| InChI | InChI=1S/C19H32O5S/c1-2-3-5-8-14(20)10-11-15-16(21)13-17(22)19(15)25-12-7-4-6-9-18(23)24/h10-11,14-16,19-21H,2-9,12-13H2,1H3,(H,23,24)/b11-10+/t14-,15-,16+,19+/m0/s1 |
| InChIKey | XPMFBRQXMYFOPC-JGEMWAQNSA-N |
| XLogP | 3.18 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|