C18H17NO6 — CID 13232594
3-(1,3-benzodioxol-5-yl)-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 13232594) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 13232594 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1ccc2c(c1)OCO2)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C18H17NO6/c20-17(21)14(8-13-6-7-15-16(9-13)25-11-24-15)19-18(22)23-10-12-4-2-1-3-5-12/h1-7,9,14H,8,10-11H2,(H,19,22)(H,20,21) |
| InChIKey | CMHUDFIUIKRMCC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |