About cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid
cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid (PubChem CID 13233439) has the molecular formula C17H24FNO5
and a molecular weight of 341.38 g/mol. Its IUPAC name is cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid.
Molecular Properties
| Compound Name | cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid |
| PubChem CID | 13233439 |
| Molecular Formula | C17H24FNO5 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid |
| SMILES | CN(C)[C@@H]1CCCC[C@@]1(O)Cc1ccccc1F.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H22FNO.C2H2O4/c1-17(2)14-9-5-6-10-15(14,18)11-12-7-3-4-8-13(12)16;3-1(4)2(5)6/h3-4,7-8,14,18H,5-6,9-11H2,1-2H3;(H,3,4)(H,5,6)/t14-,15-;/m1./s1 |
| InChIKey | MMNYOGQPJCQHFU-CTHHTMFSSA-N |
| XLogP | 1.76 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid?
The IUPAC name of cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid (CID 13233439) is cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid.
What is the SMILES notation for cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid?
The canonical SMILES for cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid is CN(C)[C@@H]1CCCC[C@@]1(O)Cc1ccccc1F.O=C(O)C(=O)O.
What is the InChIKey of cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid?
The InChIKey is MMNYOGQPJCQHFU-CTHHTMFSSA-N. The full InChI is InChI=1S/C15H22FNO.C2H2O4/c1-17(2)14-9-5-6-10-15(14,18)11-12-7-3-4-8-13(12)16;3-1(4)2(5)6/h3-4,7-8,14,18H,5-6,9-11H2,1-2H3;(H,3,4)(H,5,6)/t14-,15-;/m1./s1.
What are the key properties of cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid?
cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid has a molecular weight of 341.38 g/mol, XLogP of 1.76, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2R)-2-(dimethylamino)-1-[(2-fluorophenyl)methyl]cyclohexan-1-ol;oxalic acid is sourced from PubChem (CID 13233439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).