About N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine
N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine (PubChem CID 13233625) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine.
Molecular Properties
| Compound Name | N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine |
| PubChem CID | 13233625 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine |
| SMILES | CNCC1CCCCC12Cc1ccccc1O2 |
| InChI | InChI=1S/C15H21NO/c1-16-11-13-7-4-5-9-15(13)10-12-6-2-3-8-14(12)17-15/h2-3,6,8,13,16H,4-5,7,9-11H2,1H3 |
| InChIKey | MXRKYEGPFKGGCX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine?
The IUPAC name of N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine (CID 13233625) is N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine.
What is the SMILES notation for N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine?
The canonical SMILES for N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine is CNCC1CCCCC12Cc1ccccc1O2.
What is the InChIKey of N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine?
The InChIKey is MXRKYEGPFKGGCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-16-11-13-7-4-5-9-15(13)10-12-6-2-3-8-14(12)17-15/h2-3,6,8,13,16H,4-5,7,9-11H2,1H3.
What are the key properties of N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine?
N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine has a molecular weight of 231.34 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-spiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-ylmethanamine is sourced from PubChem (CID 13233625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).