About N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide
N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide (PubChem CID 13234274) has the molecular formula C16H20N2O4
and a molecular weight of 304.35 g/mol. Its IUPAC name is N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide |
| PubChem CID | 13234274 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1cc(C(C)(C)C)no1 |
| InChI | InChI=1S/C16H20N2O4/c1-16(2,3)12-9-13(22-18-12)17-15(19)14-10(20-4)7-6-8-11(14)21-5/h6-9H,1-5H3,(H,17,19) |
| InChIKey | BUHYKMWEYHNUTE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide?
The IUPAC name of N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide (CID 13234274) is N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide.
What is the SMILES notation for N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide?
The canonical SMILES for N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide is COc1cccc(OC)c1C(=O)Nc1cc(C(C)(C)C)no1.
What is the InChIKey of N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide?
The InChIKey is BUHYKMWEYHNUTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4/c1-16(2,3)12-9-13(22-18-12)17-15(19)14-10(20-4)7-6-8-11(14)21-5/h6-9H,1-5H3,(H,17,19).
What are the key properties of N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide?
N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide has a molecular weight of 304.35 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-tert-butyl-1,2-oxazol-5-yl)-2,6-dimethoxybenzamide is sourced from PubChem (CID 13234274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).