About N-tert-butyl-N,5,5-trimethylhexan-1-amine
N-tert-butyl-N,5,5-trimethylhexan-1-amine (PubChem CID 13234810) has the molecular formula C13H29N
and a molecular weight of 199.38 g/mol. Its IUPAC name is N-tert-butyl-N,5,5-trimethylhexan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-N,5,5-trimethylhexan-1-amine |
| PubChem CID | 13234810 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | N-tert-butyl-N,5,5-trimethylhexan-1-amine |
| SMILES | CN(CCCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H29N/c1-12(2,3)10-8-9-11-14(7)13(4,5)6/h8-11H2,1-7H3 |
| InChIKey | SVYZSPOGXAVEQT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N,5,5-trimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N,5,5-trimethylhexan-1-amine?
The IUPAC name of N-tert-butyl-N,5,5-trimethylhexan-1-amine (CID 13234810) is N-tert-butyl-N,5,5-trimethylhexan-1-amine.
What is the SMILES notation for N-tert-butyl-N,5,5-trimethylhexan-1-amine?
The canonical SMILES for N-tert-butyl-N,5,5-trimethylhexan-1-amine is CN(CCCCC(C)(C)C)C(C)(C)C.
What is the InChIKey of N-tert-butyl-N,5,5-trimethylhexan-1-amine?
The InChIKey is SVYZSPOGXAVEQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N/c1-12(2,3)10-8-9-11-14(7)13(4,5)6/h8-11H2,1-7H3.
What are the key properties of N-tert-butyl-N,5,5-trimethylhexan-1-amine?
N-tert-butyl-N,5,5-trimethylhexan-1-amine has a molecular weight of 199.38 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N,5,5-trimethylhexan-1-amine is sourced from PubChem (CID 13234810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).