About 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane
7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane (PubChem CID 13235318) has the molecular formula C9H14I2O2
and a molecular weight of 408.02 g/mol. Its IUPAC name is 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane |
| PubChem CID | 13235318 |
| Molecular Formula | C9H14I2O2 |
| Molecular Weight | 408.02 g/mol |
| Exact Mass | 407.91 |
| IUPAC Name | 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane |
| SMILES | ICC1CC2(CC1CI)OCCO2 |
| InChI | InChI=1S/C9H14I2O2/c10-5-7-3-9(4-8(7)6-11)12-1-2-13-9/h7-8H,1-6H2 |
| InChIKey | LAEANFWFDOGKRM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.02 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane?
The IUPAC name of 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane (CID 13235318) is 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane.
What is the SMILES notation for 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane?
The canonical SMILES for 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane is ICC1CC2(CC1CI)OCCO2.
What is the InChIKey of 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane?
The InChIKey is LAEANFWFDOGKRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14I2O2/c10-5-7-3-9(4-8(7)6-11)12-1-2-13-9/h7-8H,1-6H2.
What are the key properties of 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane?
7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane has a molecular weight of 408.02 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-bis(iodomethyl)-1,4-dioxaspiro[4.4]nonane is sourced from PubChem (CID 13235318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).