About H3B-120
H3B-120 (PubChem CID 132355378) has the molecular formula C19H24N4O2S
and a molecular weight of 372.50 g/mol. Its IUPAC name is 1-N-benzyl-1-N-methyl-4-N-(4-methyl-1,3-thiazol-2-yl)piperidine-1,4-dicarboxamide.
Molecular Properties
| Compound Name | H3B-120 |
| PubChem CID | 132355378 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-N-benzyl-1-N-methyl-4-N-(4-methyl-1,3-thiazol-2-yl)piperidine-1,4-dicarboxamide |
| SMILES | CC1=CSC(=N1)NC(=O)C2CCN(CC2)C(=O)N(C)CC3=CC=CC=C3 |
| InChI | InChI=1S/C19H24N4O2S/c1-14-13-26-18(20-14)21-17(24)16-8-10-23(11-9-16)19(25)22(2)12-15-6-4-3-5-7-15/h3-7,13,16H,8-12H2,1-2H3,(H,20,21,24) |
| InChIKey | ZEVOZXRSCSSPAO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | 490 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze H3B-120 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of H3B-120?
The IUPAC name of H3B-120 (CID 132355378) is 1-N-benzyl-1-N-methyl-4-N-(4-methyl-1,3-thiazol-2-yl)piperidine-1,4-dicarboxamide.
What is the SMILES notation for H3B-120?
The canonical SMILES for H3B-120 is CC1=CSC(=N1)NC(=O)C2CCN(CC2)C(=O)N(C)CC3=CC=CC=C3.
What is the InChIKey of H3B-120?
The InChIKey is ZEVOZXRSCSSPAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O2S/c1-14-13-26-18(20-14)21-17(24)16-8-10-23(11-9-16)19(25)22(2)12-15-6-4-3-5-7-15/h3-7,13,16H,8-12H2,1-2H3,(H,20,21,24).
What are the key properties of H3B-120?
H3B-120 has a molecular weight of 372.50 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for H3B-120 is sourced from PubChem (CID 132355378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).