About 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide
2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide (PubChem CID 13235645) has the molecular formula C14H20N4O2
and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide |
| PubChem CID | 13235645 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide |
| SMILES | CNC(=O)c1cc(N2CCCCC2)cc(C(=O)NC)n1 |
| InChI | InChI=1S/C14H20N4O2/c1-15-13(19)11-8-10(18-6-4-3-5-7-18)9-12(17-11)14(20)16-2/h8-9H,3-7H2,1-2H3,(H,15,19)(H,16,20) |
| InChIKey | HIPWTMGVNBESLS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide?
The IUPAC name of 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide (CID 13235645) is 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide.
What is the SMILES notation for 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide?
The canonical SMILES for 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide is CNC(=O)c1cc(N2CCCCC2)cc(C(=O)NC)n1.
What is the InChIKey of 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide?
The InChIKey is HIPWTMGVNBESLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O2/c1-15-13(19)11-8-10(18-6-4-3-5-7-18)9-12(17-11)14(20)16-2/h8-9H,3-7H2,1-2H3,(H,15,19)(H,16,20).
What are the key properties of 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide?
2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide has a molecular weight of 276.34 g/mol, XLogP of 0.79, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-N-dimethyl-4-piperidin-1-ylpyridine-2,6-dicarboxamide is sourced from PubChem (CID 13235645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).