About 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide
4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide (PubChem CID 13235649) has the molecular formula C11H15N3O2S
and a molecular weight of 253.33 g/mol. Its IUPAC name is 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide.
Molecular Properties
| Compound Name | 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide |
| PubChem CID | 13235649 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide |
| SMILES | CCSc1cc(C(=O)NC)nc(C(=O)NC)c1 |
| InChI | InChI=1S/C11H15N3O2S/c1-4-17-7-5-8(10(15)12-2)14-9(6-7)11(16)13-3/h5-6H,4H2,1-3H3,(H,12,15)(H,13,16) |
| InChIKey | IHYGXTPIHQIROK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide?
The IUPAC name of 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide (CID 13235649) is 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide.
What is the SMILES notation for 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide?
The canonical SMILES for 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide is CCSc1cc(C(=O)NC)nc(C(=O)NC)c1.
What is the InChIKey of 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide?
The InChIKey is IHYGXTPIHQIROK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2S/c1-4-17-7-5-8(10(15)12-2)14-9(6-7)11(16)13-3/h5-6H,4H2,1-3H3,(H,12,15)(H,13,16).
What are the key properties of 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide?
4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide has a molecular weight of 253.33 g/mol, XLogP of 0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfanyl-2-N,6-N-dimethylpyridine-2,6-dicarboxamide is sourced from PubChem (CID 13235649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).