About 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene
8-methyl-1,6-dioxaspiro[4.5]dec-7-ene (PubChem CID 13237180) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene.
Molecular Properties
| Compound Name | 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene |
| PubChem CID | 13237180 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene |
| SMILES | CC1=COC2(CCCO2)CC1 |
| InChI | InChI=1S/C9H14O2/c1-8-3-5-9(11-7-8)4-2-6-10-9/h7H,2-6H2,1H3 |
| InChIKey | HWCUIJGHLFHWTC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene?
The IUPAC name of 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene (CID 13237180) is 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene.
What is the SMILES notation for 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene?
The canonical SMILES for 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene is CC1=COC2(CCCO2)CC1.
What is the InChIKey of 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene?
The InChIKey is HWCUIJGHLFHWTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-8-3-5-9(11-7-8)4-2-6-10-9/h7H,2-6H2,1H3.
What are the key properties of 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene?
8-methyl-1,6-dioxaspiro[4.5]dec-7-ene has a molecular weight of 154.21 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,6-dioxaspiro[4.5]dec-7-ene is sourced from PubChem (CID 13237180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).