About 1-bromothieno[3,4-g][2]benzothiole
1-bromothieno[3,4-g][2]benzothiole (PubChem CID 13237998) has the molecular formula C10H5BrS2
and a molecular weight of 269.19 g/mol. Its IUPAC name is 1-bromothieno[3,4-g][2]benzothiole.
Molecular Properties
| Compound Name | 1-bromothieno[3,4-g][2]benzothiole |
| PubChem CID | 13237998 |
| Molecular Formula | C10H5BrS2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 267.90 |
| IUPAC Name | 1-bromothieno[3,4-g][2]benzothiole |
| SMILES | Brc1scc2ccc3cscc3c12 |
| InChI | InChI=1S/C10H5BrS2/c11-10-9-7(4-13-10)2-1-6-3-12-5-8(6)9/h1-5H |
| InChIKey | QDLUUWIECQAOLE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromothieno[3,4-g][2]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromothieno[3,4-g][2]benzothiole?
The IUPAC name of 1-bromothieno[3,4-g][2]benzothiole (CID 13237998) is 1-bromothieno[3,4-g][2]benzothiole.
What is the SMILES notation for 1-bromothieno[3,4-g][2]benzothiole?
The canonical SMILES for 1-bromothieno[3,4-g][2]benzothiole is Brc1scc2ccc3cscc3c12.
What is the InChIKey of 1-bromothieno[3,4-g][2]benzothiole?
The InChIKey is QDLUUWIECQAOLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrS2/c11-10-9-7(4-13-10)2-1-6-3-12-5-8(6)9/h1-5H.
What are the key properties of 1-bromothieno[3,4-g][2]benzothiole?
1-bromothieno[3,4-g][2]benzothiole has a molecular weight of 269.19 g/mol, XLogP of 4.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromothieno[3,4-g][2]benzothiole is sourced from PubChem (CID 13237998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).