C20H17N3OS — CID 13238085
(NE)-N-[1-(3-methyl-5,6-diphenylimidazo[2,1-b][1,3]thiazol-2-yl)ethylidene]hydroxylamine (PubChem CID 13238085) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is (NE)-N-[1-(3-methyl-5,6-diphenylimidazo[2,1-b][1,3]thiazol-2-yl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(3-methyl-5,6-diphenylimidazo[2,1-b][1,3]thiazol-2-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 13238085 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (NE)-N-[1-(3-methyl-5,6-diphenylimidazo[2,1-b][1,3]thiazol-2-yl)ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1sc2nc(-c3ccccc3)c(-c3ccccc3)n2c1C |
| InChI | InChI=1S/C20H17N3OS/c1-13(22-24)19-14(2)23-18(16-11-7-4-8-12-16)17(21-20(23)25-19)15-9-5-3-6-10-15/h3-12,24H,1-2H3/b22-13+ |
| InChIKey | JDWGYYULSFYGCP-LPYMAVHISA-N |
| XLogP | 5.24 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|