4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid

C16H13N5O3S — CID 1323900

IUPAC4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid
SMILESO=C(CSc1nnnn1-c1ccc(C(=O)O)cc1)Nc1ccccc1
InChIInChI=1S/C16H13N5O3S/c22-14(17-12-4-2-1-3-5-12)10-25-16-18-19-20-21(16)13-8-6-11(7-9-13)15(23)24/h1-9H,10H2,(H,17,22)(H,23,24)
InChIKeyGYVIBFGWXASIJR-UHFFFAOYSA-N
MW355.38 g/mol
LogP2.09
Rot. Bonds6

About 4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid

4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid (PubChem CID 1323900) has the molecular formula C16H13N5O3S and a molecular weight of 355.38 g/mol. Its IUPAC name is 4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid.

Molecular Properties

Compound Name4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid
PubChem CID1323900
Molecular FormulaC16H13N5O3S
Molecular Weight355.38 g/mol
Exact Mass355.07
IUPAC Name4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid
SMILESO=C(CSc1nnnn1-c1ccc(C(=O)O)cc1)Nc1ccccc1
InChIInChI=1S/C16H13N5O3S/c22-14(17-12-4-2-1-3-5-12)10-25-16-18-19-20-21(16)13-8-6-11(7-9-13)15(23)24/h1-9H,10H2,(H,17,22)(H,23,24)
InChIKeyGYVIBFGWXASIJR-UHFFFAOYSA-N
XLogP2.09
TPSA110.00 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500355.38
LogP ≤ 52.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Analyze 4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid?
The IUPAC name of 4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid (CID 1323900) is 4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid.
What is the SMILES notation for 4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid?
The canonical SMILES for 4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid is O=C(CSc1nnnn1-c1ccc(C(=O)O)cc1)Nc1ccccc1.
What is the InChIKey of 4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid?
The InChIKey is GYVIBFGWXASIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5O3S/c22-14(17-12-4-2-1-3-5-12)10-25-16-18-19-20-21(16)13-8-6-11(7-9-13)15(23)24/h1-9H,10H2,(H,17,22)(H,23,24).
What are the key properties of 4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid?
4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid has a molecular weight of 355.38 g/mol, XLogP of 2.09, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2-anilino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoic acid is sourced from PubChem (CID 1323900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).