C15H27NO2 — CID 13239734
tert-butyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ylamino)acetate (PubChem CID 13239734) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is tert-butyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ylamino)acetate.
| Compound Name | tert-butyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ylamino)acetate |
|---|---|
| PubChem CID | 13239734 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | tert-butyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ylamino)acetate |
| SMILES | CC(C)(C)OC(=O)CNC1CC2CCCCC2C1 |
| InChI | InChI=1S/C15H27NO2/c1-15(2,3)18-14(17)10-16-13-8-11-6-4-5-7-12(11)9-13/h11-13,16H,4-10H2,1-3H3 |
| InChIKey | JSORCJMTZJLLHL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |