C14H14NOS+ — CID 13240441
11,11-dimethyl-10-thia-1-azoniatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-12-one (PubChem CID 13240441) has the molecular formula C14H14NOS+ and a molecular weight of 244.34 g/mol. Its IUPAC name is 11,11-dimethyl-10-thia-1-azoniatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-12-one.
| Compound Name | 11,11-dimethyl-10-thia-1-azoniatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-12-one |
|---|---|
| PubChem CID | 13240441 |
| Molecular Formula | C14H14NOS+ |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 11,11-dimethyl-10-thia-1-azoniatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-12-one |
| SMILES | CC1(C)Sc2cccc3ccc[n+](c23)CC1=O |
| InChI | InChI=1S/C14H14NOS/c1-14(2)12(16)9-15-8-4-6-10-5-3-7-11(17-14)13(10)15/h3-8H,9H2,1-2H3/q+1 |
| InChIKey | XOUUMQKSNHORCL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|