C26H22N2O4 — CID 13240775
methyl (1S,3S,3aS,6aR)-4,6-dioxo-1,3,5-triphenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 13240775) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is methyl (1S,3S,3aS,6aR)-4,6-dioxo-1,3,5-triphenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3S,3aS,6aR)-4,6-dioxo-1,3,5-triphenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 13240775 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | methyl (1S,3S,3aS,6aR)-4,6-dioxo-1,3,5-triphenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)N[C@H](c2ccccc2)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C26H22N2O4/c1-32-25(31)26(18-13-7-3-8-14-18)21-20(22(27-26)17-11-5-2-6-12-17)23(29)28(24(21)30)19-15-9-4-10-16-19/h2-16,20-22,27H,1H3/t20-,21-,22-,26-/m1/s1 |
| InChIKey | GPTDGWQMFIIWRO-PIXQIBFHSA-N |
| XLogP | 3.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|