C25H29N5O — CID 13241085
4-[(E)-2-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 13241085) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-[(E)-2-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[(E)-2-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 13241085 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 4-[(E)-2-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | C/C(=C\c1ccc(C(=O)Nc2nn[nH]n2)cc1)c1ccc2c(c1)C(C)(C)C(C)C2(C)C |
| InChI | InChI=1S/C25H29N5O/c1-15(19-11-12-20-21(14-19)25(5,6)16(2)24(20,3)4)13-17-7-9-18(10-8-17)22(31)26-23-27-29-30-28-23/h7-14,16H,1-6H3,(H2,26,27,28,29,30,31)/b15-13+ |
| InChIKey | PRJDLNDRGWKKOP-FYWRMAATSA-N |
| XLogP | 5.22 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|