C24H27N5O — CID 13241088
4-[(E)-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 13241088) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-[(E)-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[(E)-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 13241088 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 4-[(E)-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | C/C(=C\c1ccc(C(=O)Nc2nn[nH]n2)cc1)c1ccc2c(c1)C(C)(C)CC2(C)C |
| InChI | InChI=1S/C24H27N5O/c1-15(18-10-11-19-20(13-18)24(4,5)14-23(19,2)3)12-16-6-8-17(9-7-16)21(30)25-22-26-28-29-27-22/h6-13H,14H2,1-5H3,(H2,25,26,27,28,29,30)/b15-12+ |
| InChIKey | XVZQPXYEFSGPGI-NTCAYCPXSA-N |
| XLogP | 4.97 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|