About 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol
4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol (PubChem CID 13241280) has the molecular formula C17H20O4
and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol |
| PubChem CID | 13241280 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CCCCCc2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C17H20O4/c18-14-8-6-12(10-16(14)20)4-2-1-3-5-13-7-9-15(19)17(21)11-13/h6-11,18-21H,1-5H2 |
| InChIKey | DOEBUYDJJCKVOO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol?
The IUPAC name of 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol (CID 13241280) is 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol.
What is the SMILES notation for 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol?
The canonical SMILES for 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol is Oc1ccc(CCCCCc2ccc(O)c(O)c2)cc1O.
What is the InChIKey of 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol?
The InChIKey is DOEBUYDJJCKVOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O4/c18-14-8-6-12(10-16(14)20)4-2-1-3-5-13-7-9-15(19)17(21)11-13/h6-11,18-21H,1-5H2.
What are the key properties of 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol?
4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol has a molecular weight of 288.34 g/mol, XLogP of 3.46, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3,4-dihydroxyphenyl)pentyl]benzene-1,2-diol is sourced from PubChem (CID 13241280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).