C18H22N2O4 — CID 13241316
cis-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-3-(cyclobutylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 13241316) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is cis-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-3-(cyclobutylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-3-(cyclobutylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 13241316 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | cis-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-3-(cyclobutylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C#CCN1CC(=O)N(COC(=O)[C@@H]2[C@@H](C=C3CCC3)C2(C)C)C1=O |
| InChI | InChI=1S/C18H22N2O4/c1-4-8-19-10-14(21)20(17(19)23)11-24-16(22)15-13(18(15,2)3)9-12-6-5-7-12/h1,9,13,15H,5-8,10-11H2,2-3H3/t13-,15+/m1/s1 |
| InChIKey | UWFCTHZNEIAHHN-HIFRSBDPSA-N |
| XLogP | 1.77 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|