C18H16ClNO4 — CID 13242063
prop-2-enyl 4-(3-chlorophenyl)-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate (PubChem CID 13242063) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is prop-2-enyl 4-(3-chlorophenyl)-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate.
| Compound Name | prop-2-enyl 4-(3-chlorophenyl)-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 13242063 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | prop-2-enyl 4-(3-chlorophenyl)-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)NC2=C(C(=O)OC2)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16ClNO4/c1-3-7-23-17(21)14-10(2)20-13-9-24-18(22)16(13)15(14)11-5-4-6-12(19)8-11/h3-6,8,15,20H,1,7,9H2,2H3 |
| InChIKey | YKENGYFVGMXDJP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|