C15H12BrN3OS — CID 1324347
4-benzyl-3-(5-bromo-2-hydroxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 1324347) has the molecular formula C15H12BrN3OS and a molecular weight of 362.25 g/mol. Its IUPAC name is 4-benzyl-3-(5-bromo-2-hydroxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-benzyl-3-(5-bromo-2-hydroxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 1324347 |
| Molecular Formula | C15H12BrN3OS |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 4-benzyl-3-(5-bromo-2-hydroxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Oc1ccc(Br)cc1-c1n[nH]c(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C15H12BrN3OS/c16-11-6-7-13(20)12(8-11)14-17-18-15(21)19(14)9-10-4-2-1-3-5-10/h1-8,20H,9H2,(H,18,21) |
| InChIKey | VCPDKEGUUWNTQU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|