C25H34O3 — CID 13243595
methyl (4R)-4-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 13243595) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is methyl (4R)-4-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 13243595 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | methyl (4R)-4-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C=CC4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H34O3/c1-16(5-10-23(27)28-4)20-8-9-21-19-7-6-17-15-18(26)11-13-24(17,2)22(19)12-14-25(20,21)3/h6-7,11,13,15-16,19-22H,5,8-10,12,14H2,1-4H3/t16-,19+,20-,21+,22+,24+,25-/m1/s1 |
| InChIKey | MOELZASDGSLFKD-RYVXGLMXSA-N |
| XLogP | 5.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |