About phenazine-2,3,7-triamine
phenazine-2,3,7-triamine (PubChem CID 13244876) has the molecular formula C12H11N5
and a molecular weight of 225.25 g/mol. Its IUPAC name is phenazine-2,3,7-triamine.
Molecular Properties
| Compound Name | phenazine-2,3,7-triamine |
| PubChem CID | 13244876 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | phenazine-2,3,7-triamine |
| SMILES | Nc1ccc2nc3cc(N)c(N)cc3nc2c1 |
| InChI | InChI=1S/C12H11N5/c13-6-1-2-9-10(3-6)17-12-5-8(15)7(14)4-11(12)16-9/h1-5H,13-15H2 |
| InChIKey | NPSHKYRLDHUWLW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze phenazine-2,3,7-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenazine-2,3,7-triamine?
The IUPAC name of phenazine-2,3,7-triamine (CID 13244876) is phenazine-2,3,7-triamine.
What is the SMILES notation for phenazine-2,3,7-triamine?
The canonical SMILES for phenazine-2,3,7-triamine is Nc1ccc2nc3cc(N)c(N)cc3nc2c1.
What is the InChIKey of phenazine-2,3,7-triamine?
The InChIKey is NPSHKYRLDHUWLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5/c13-6-1-2-9-10(3-6)17-12-5-8(15)7(14)4-11(12)16-9/h1-5H,13-15H2.
What are the key properties of phenazine-2,3,7-triamine?
phenazine-2,3,7-triamine has a molecular weight of 225.25 g/mol, XLogP of 1.53, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenazine-2,3,7-triamine is sourced from PubChem (CID 13244876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).