About 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione
5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione (PubChem CID 13245428) has the molecular formula C18H16ClNO2
and a molecular weight of 313.78 g/mol. Its IUPAC name is 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione |
| PubChem CID | 13245428 |
| Molecular Formula | C18H16ClNO2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione |
| SMILES | CCc1cccc(CC)c1N1C(=O)c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C18H16ClNO2/c1-3-11-6-5-7-12(4-2)16(11)20-17(21)14-9-8-13(19)10-15(14)18(20)22/h5-10H,3-4H2,1-2H3 |
| InChIKey | KVGUJUPBJCCIRR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione?
The IUPAC name of 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione (CID 13245428) is 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione.
What is the SMILES notation for 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione?
The canonical SMILES for 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione is CCc1cccc(CC)c1N1C(=O)c2ccc(Cl)cc2C1=O.
What is the InChIKey of 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione?
The InChIKey is KVGUJUPBJCCIRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClNO2/c1-3-11-6-5-7-12(4-2)16(11)20-17(21)14-9-8-13(19)10-15(14)18(20)22/h5-10H,3-4H2,1-2H3.
What are the key properties of 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione?
5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione has a molecular weight of 313.78 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(2,6-diethylphenyl)isoindole-1,3-dione is sourced from PubChem (CID 13245428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).