About [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate
[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate (PubChem CID 1324553) has the molecular formula C22H16O5S
and a molecular weight of 392.43 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate.
Molecular Properties
| Compound Name | [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate |
| PubChem CID | 1324553 |
| Molecular Formula | C22H16O5S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate |
| SMILES | COc1ccc(-c2cc(=O)oc3c(C)c(OC(=O)c4cccs4)ccc23)cc1 |
| InChI | InChI=1S/C22H16O5S/c1-13-18(26-22(24)19-4-3-11-28-19)10-9-16-17(12-20(23)27-21(13)16)14-5-7-15(25-2)8-6-14/h3-12H,1-2H3 |
| InChIKey | LAPIFNRGJPLMSF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate?
The IUPAC name of [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate (CID 1324553) is [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate.
What is the SMILES notation for [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate?
The canonical SMILES for [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate is COc1ccc(-c2cc(=O)oc3c(C)c(OC(=O)c4cccs4)ccc23)cc1.
What is the InChIKey of [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate?
The InChIKey is LAPIFNRGJPLMSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16O5S/c1-13-18(26-22(24)19-4-3-11-28-19)10-9-16-17(12-20(23)27-21(13)16)14-5-7-15(25-2)8-6-14/h3-12H,1-2H3.
What are the key properties of [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate?
[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate has a molecular weight of 392.43 g/mol, XLogP of 5.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] thiophene-2-carboxylate is sourced from PubChem (CID 1324553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).