About 1-methylcubane
1-methylcubane (PubChem CID 13245707) has the molecular formula C9H10
and a molecular weight of 118.18 g/mol. Its IUPAC name is 1-methylcubane.
Molecular Properties
| Compound Name | 1-methylcubane |
| PubChem CID | 13245707 |
| Molecular Formula | C9H10 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 1-methylcubane |
| SMILES | CC12C3C4C5C3C1C5C42 |
| InChI | InChI=1S/C9H10/c1-9-6-3-2-4(6)8(9)5(2)7(3)9/h2-8H,1H3 |
| InChIKey | UXKDTZFBSHLJOY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methylcubane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcubane?
The IUPAC name of 1-methylcubane (CID 13245707) is 1-methylcubane.
What is the SMILES notation for 1-methylcubane?
The canonical SMILES for 1-methylcubane is CC12C3C4C5C3C1C5C42.
What is the InChIKey of 1-methylcubane?
The InChIKey is UXKDTZFBSHLJOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10/c1-9-6-3-2-4(6)8(9)5(2)7(3)9/h2-8H,1H3.
What are the key properties of 1-methylcubane?
1-methylcubane has a molecular weight of 118.18 g/mol, XLogP of 1.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcubane is sourced from PubChem (CID 13245707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).