About 2-aminobut-3-en-1-ol
2-aminobut-3-en-1-ol (PubChem CID 13247016) has the molecular formula C4H9NO
and a molecular weight of 87.12 g/mol. Its IUPAC name is 2-aminobut-3-en-1-ol.
Molecular Properties
| Compound Name | 2-aminobut-3-en-1-ol |
| PubChem CID | 13247016 |
| Molecular Formula | C4H9NO |
| Molecular Weight | 87.12 g/mol |
| Exact Mass | 87.07 |
| IUPAC Name | 2-aminobut-3-en-1-ol |
| SMILES | C=CC(N)CO |
| InChI | InChI=1S/C4H9NO/c1-2-4(5)3-6/h2,4,6H,1,3,5H2 |
| InChIKey | RKBAYXYCMQLBCZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.12 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobut-3-en-1-ol?
The IUPAC name of 2-aminobut-3-en-1-ol (CID 13247016) is 2-aminobut-3-en-1-ol.
What is the SMILES notation for 2-aminobut-3-en-1-ol?
The canonical SMILES for 2-aminobut-3-en-1-ol is C=CC(N)CO.
What is the InChIKey of 2-aminobut-3-en-1-ol?
The InChIKey is RKBAYXYCMQLBCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO/c1-2-4(5)3-6/h2,4,6H,1,3,5H2.
What are the key properties of 2-aminobut-3-en-1-ol?
2-aminobut-3-en-1-ol has a molecular weight of 87.12 g/mol, XLogP of -0.51, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobut-3-en-1-ol is sourced from PubChem (CID 13247016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).