C10H18N2O2 — CID 13247186
1,3,3,4,5,5-hexamethylpiperazine-2,6-dione (PubChem CID 13247186) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,3,3,4,5,5-hexamethylpiperazine-2,6-dione.
| Compound Name | 1,3,3,4,5,5-hexamethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 13247186 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1,3,3,4,5,5-hexamethylpiperazine-2,6-dione |
| SMILES | CN1C(=O)C(C)(C)N(C)C(C)(C)C1=O |
| InChI | InChI=1S/C10H18N2O2/c1-9(2)7(13)11(5)8(14)10(3,4)12(9)6/h1-6H3 |
| InChIKey | LIGLONZPBPKXNO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|