C15H18N2O3 — CID 13247709
(1-methylpiperidin-3-yl) 2-(1,2-benzoxazol-3-yl)acetate (PubChem CID 13247709) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (1-methylpiperidin-3-yl) 2-(1,2-benzoxazol-3-yl)acetate.
| Compound Name | (1-methylpiperidin-3-yl) 2-(1,2-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 13247709 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (1-methylpiperidin-3-yl) 2-(1,2-benzoxazol-3-yl)acetate |
| SMILES | CN1CCCC(OC(=O)Cc2noc3ccccc23)C1 |
| InChI | InChI=1S/C15H18N2O3/c1-17-8-4-5-11(10-17)19-15(18)9-13-12-6-2-3-7-14(12)20-16-13/h2-3,6-7,11H,4-5,8-10H2,1H3 |
| InChIKey | DYINVEIYPZDVDI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |