About 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one
3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one (PubChem CID 13248551) has the molecular formula C12H9BrCl2O
and a molecular weight of 320.01 g/mol. Its IUPAC name is 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one |
| PubChem CID | 13248551 |
| Molecular Formula | C12H9BrCl2O |
| Molecular Weight | 320.01 g/mol |
| Exact Mass | 317.92 |
| IUPAC Name | 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one |
| SMILES | O=C1C=C(Br)CC(c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C12H9BrCl2O/c13-8-3-7(4-10(16)5-8)11-2-1-9(14)6-12(11)15/h1-2,5-7H,3-4H2 |
| InChIKey | FXLTXPJSOVLVBK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.01 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one?
The IUPAC name of 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one (CID 13248551) is 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one.
What is the SMILES notation for 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one?
The canonical SMILES for 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one is O=C1C=C(Br)CC(c2ccc(Cl)cc2Cl)C1.
What is the InChIKey of 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one?
The InChIKey is FXLTXPJSOVLVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrCl2O/c13-8-3-7(4-10(16)5-8)11-2-1-9(14)6-12(11)15/h1-2,5-7H,3-4H2.
What are the key properties of 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one?
3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one has a molecular weight of 320.01 g/mol, XLogP of 4.72, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(2,4-dichlorophenyl)cyclohex-2-en-1-one is sourced from PubChem (CID 13248551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).