C13H20O4 — CID 132487779
methyl (E)-2,4,6-trimethyl-3,5-dioxonon-6-enoate (PubChem CID 132487779) has the molecular formula C13H20O4 and a molecular weight of 240.29 g/mol. Its IUPAC name is methyl (E)-2,4,6-trimethyl-3,5-dioxonon-6-enoate.
| Compound Name | methyl (E)-2,4,6-trimethyl-3,5-dioxonon-6-enoate |
|---|---|
| PubChem CID | 132487779 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | methyl (E)-2,4,6-trimethyl-3,5-dioxonon-6-enoate |
| SMILES | CC/C=C(\C)/C(=O)C(C)C(=O)C(C)C(=O)OC |
| InChI | InChI=1S/C13H20O4/c1-6-7-8(2)11(14)9(3)12(15)10(4)13(16)17-5/h7,9-10H,6H2,1-5H3/b8-7+ |
| InChIKey | VBFLCLDSGGWWJP-BQYQJAHWSA-N |
| XLogP | 2.60 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | 341 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|