3-trichlorogermylbutanoyl chloride

C4H6Cl4GeO — CID 13249036

IUPAC3-trichlorogermylbutanoyl chloride
SMILESCC(CC(=O)Cl)[Ge](Cl)(Cl)Cl
InChIInChI=1S/C4H6Cl4GeO/c1-3(2-4(5)10)9(6,7)8/h3H,2H2,1H3
InChIKeyIKHZITMUHDPORA-UHFFFAOYSA-N
MW284.51 g/mol
LogP3.19
Rot. Bonds3

About 3-trichlorogermylbutanoyl chloride

3-trichlorogermylbutanoyl chloride (PubChem CID 13249036) has the molecular formula C4H6Cl4GeO and a molecular weight of 284.51 g/mol. Its IUPAC name is 3-trichlorogermylbutanoyl chloride.

Molecular Properties

Compound Name3-trichlorogermylbutanoyl chloride
PubChem CID13249036
Molecular FormulaC4H6Cl4GeO
Molecular Weight284.51 g/mol
Exact Mass283.84
IUPAC Name3-trichlorogermylbutanoyl chloride
SMILESCC(CC(=O)Cl)[Ge](Cl)(Cl)Cl
InChIInChI=1S/C4H6Cl4GeO/c1-3(2-4(5)10)9(6,7)8/h3H,2H2,1H3
InChIKeyIKHZITMUHDPORA-UHFFFAOYSA-N
XLogP3.19
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.51
LogP ≤ 53.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-trichlorogermylbutanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-trichlorogermylbutanoyl chloride?
The IUPAC name of 3-trichlorogermylbutanoyl chloride (CID 13249036) is 3-trichlorogermylbutanoyl chloride.
What is the SMILES notation for 3-trichlorogermylbutanoyl chloride?
The canonical SMILES for 3-trichlorogermylbutanoyl chloride is CC(CC(=O)Cl)[Ge](Cl)(Cl)Cl.
What is the InChIKey of 3-trichlorogermylbutanoyl chloride?
The InChIKey is IKHZITMUHDPORA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Cl4GeO/c1-3(2-4(5)10)9(6,7)8/h3H,2H2,1H3.
What are the key properties of 3-trichlorogermylbutanoyl chloride?
3-trichlorogermylbutanoyl chloride has a molecular weight of 284.51 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trichlorogermylbutanoyl chloride is sourced from PubChem (CID 13249036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).