About [(6R)-tridec-7-yn-6-yl] methanesulfonate
[(6R)-tridec-7-yn-6-yl] methanesulfonate (PubChem CID 13249582) has the molecular formula C14H26O3S
and a molecular weight of 274.43 g/mol. Its IUPAC name is [(6R)-tridec-7-yn-6-yl] methanesulfonate.
Molecular Properties
| Compound Name | [(6R)-tridec-7-yn-6-yl] methanesulfonate |
| PubChem CID | 13249582 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [(6R)-tridec-7-yn-6-yl] methanesulfonate |
| SMILES | CCCCCC#C[C@@H](CCCCC)OS(C)(=O)=O |
| InChI | InChI=1S/C14H26O3S/c1-4-6-8-9-11-13-14(12-10-7-5-2)17-18(3,15)16/h14H,4-10,12H2,1-3H3/t14-/m1/s1 |
| InChIKey | ODQTUCKNTBNPGZ-CQSZACIVSA-N |
| XLogP | 3.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(6R)-tridec-7-yn-6-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6R)-tridec-7-yn-6-yl] methanesulfonate?
The IUPAC name of [(6R)-tridec-7-yn-6-yl] methanesulfonate (CID 13249582) is [(6R)-tridec-7-yn-6-yl] methanesulfonate.
What is the SMILES notation for [(6R)-tridec-7-yn-6-yl] methanesulfonate?
The canonical SMILES for [(6R)-tridec-7-yn-6-yl] methanesulfonate is CCCCCC#C[C@@H](CCCCC)OS(C)(=O)=O.
What is the InChIKey of [(6R)-tridec-7-yn-6-yl] methanesulfonate?
The InChIKey is ODQTUCKNTBNPGZ-CQSZACIVSA-N. The full InChI is InChI=1S/C14H26O3S/c1-4-6-8-9-11-13-14(12-10-7-5-2)17-18(3,15)16/h14H,4-10,12H2,1-3H3/t14-/m1/s1.
What are the key properties of [(6R)-tridec-7-yn-6-yl] methanesulfonate?
[(6R)-tridec-7-yn-6-yl] methanesulfonate has a molecular weight of 274.43 g/mol, XLogP of 3.50, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(6R)-tridec-7-yn-6-yl] methanesulfonate is sourced from PubChem (CID 13249582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).