About ethyl 3,4,5-trihydroxybenzoate
ethyl 3,4,5-trihydroxybenzoate (PubChem CID 13250) has the molecular formula C9H10O5
and a molecular weight of 198.17 g/mol. Its IUPAC name is ethyl 3,4,5-trihydroxybenzoate.
Molecular Properties
| Compound Name | ethyl 3,4,5-trihydroxybenzoate |
| PubChem CID | 13250 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | ethyl 3,4,5-trihydroxybenzoate |
| SMILES | CCOC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C9H10O5/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4,10-12H,2H2,1H3 |
| InChIKey | VFPFQHQNJCMNBZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3,4,5-trihydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3,4,5-trihydroxybenzoate?
The IUPAC name of ethyl 3,4,5-trihydroxybenzoate (CID 13250) is ethyl 3,4,5-trihydroxybenzoate.
What is the SMILES notation for ethyl 3,4,5-trihydroxybenzoate?
The canonical SMILES for ethyl 3,4,5-trihydroxybenzoate is CCOC(=O)c1cc(O)c(O)c(O)c1.
What is the InChIKey of ethyl 3,4,5-trihydroxybenzoate?
The InChIKey is VFPFQHQNJCMNBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O5/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4,10-12H,2H2,1H3.
What are the key properties of ethyl 3,4,5-trihydroxybenzoate?
ethyl 3,4,5-trihydroxybenzoate has a molecular weight of 198.17 g/mol, XLogP of 0.98, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,4,5-trihydroxybenzoate is sourced from PubChem (CID 13250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).