C25H28N2O3 — CID 132500153
N-[(3S)-1-(2-oxochromen-4-yl)azepan-3-yl]-3-phenylbutanamide (PubChem CID 132500153) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[(3S)-1-(2-oxochromen-4-yl)azepan-3-yl]-3-phenylbutanamide.
| Compound Name | N-[(3S)-1-(2-oxochromen-4-yl)azepan-3-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 132500153 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-[(3S)-1-(2-oxochromen-4-yl)azepan-3-yl]-3-phenylbutanamide |
| SMILES | CC(CC(=O)N[C@H]1CCCCN(c2cc(=O)oc3ccccc23)C1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O3/c1-18(19-9-3-2-4-10-19)15-24(28)26-20-11-7-8-14-27(17-20)22-16-25(29)30-23-13-6-5-12-21(22)23/h2-6,9-10,12-13,16,18,20H,7-8,11,14-15,17H2,1H3,(H,26,28)/t18?,20-/m0/s1 |
| InChIKey | UCAQSOINKICUHN-IJHRGXPZSA-N |
| XLogP | 4.46 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|